C7H3ClF3NS — CID 135379068
N-(2,3,5-trifluorophenyl)carbamothioyl chloride (PubChem CID 135379068) has the molecular formula C7H3ClF3NS and a molecular weight of 225.62 g/mol. Its IUPAC name is N-(2,3,5-trifluorophenyl)carbamothioyl chloride.
| Compound Name | N-(2,3,5-trifluorophenyl)carbamothioyl chloride |
|---|---|
| PubChem CID | 135379068 |
| Molecular Formula | C7H3ClF3NS |
| Molecular Weight | 225.62 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | N-(2,3,5-trifluorophenyl)carbamothioyl chloride |
| SMILES | Fc1cc(F)c(F)c(NC(=S)Cl)c1 |
| InChI | InChI=1S/C7H3ClF3NS/c8-7(13)12-5-2-3(9)1-4(10)6(5)11/h1-2H,(H,12,13) |
| InChIKey | QGNFNLJRTUKMKA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|