C8H6F4N2O4 — CID 174887375
1-fluoro-2-(2,3,5-trifluorophenyl)hydrazine;oxalic acid (PubChem CID 174887375) has the molecular formula C8H6F4N2O4 and a molecular weight of 270.14 g/mol. Its IUPAC name is 1-fluoro-2-(2,3,5-trifluorophenyl)hydrazine;oxalic acid.
| Compound Name | 1-fluoro-2-(2,3,5-trifluorophenyl)hydrazine;oxalic acid |
|---|---|
| PubChem CID | 174887375 |
| Molecular Formula | C8H6F4N2O4 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-fluoro-2-(2,3,5-trifluorophenyl)hydrazine;oxalic acid |
| SMILES | FNNc1cc(F)cc(F)c1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C6H4F4N2.C2H2O4/c7-3-1-4(8)6(9)5(2-3)11-12-10;3-1(4)2(5)6/h1-2,11-12H;(H,3,4)(H,5,6) |
| InChIKey | QZTIIEYURPDGFZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|