C15H12F3NOS — CID 107028642
3-phenyl-2-sulfanyl-N-(2,3,5-trifluorophenyl)propanamide (PubChem CID 107028642) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-phenyl-2-sulfanyl-N-(2,3,5-trifluorophenyl)propanamide.
| Compound Name | 3-phenyl-2-sulfanyl-N-(2,3,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 107028642 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-phenyl-2-sulfanyl-N-(2,3,5-trifluorophenyl)propanamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C15H12F3NOS/c16-10-7-11(17)14(18)12(8-10)19-15(20)13(21)6-9-4-2-1-3-5-9/h1-5,7-8,13,21H,6H2,(H,19,20) |
| InChIKey | SSSFBBXRTICSFZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|