C16H16FNOS — CID 107021266
N-(3-fluoro-4-methylphenyl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 107021266) has the molecular formula C16H16FNOS and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107021266 |
| Molecular Formula | C16H16FNOS |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=O)C(S)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C16H16FNOS/c1-11-7-8-13(10-14(11)17)18-16(19)15(20)9-12-5-3-2-4-6-12/h2-8,10,15,20H,9H2,1H3,(H,18,19) |
| InChIKey | LAANYMZOHRLSPI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|