C15H12Cl3NOS — CID 107020178
3-phenyl-2-sulfanyl-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 107020178) has the molecular formula C15H12Cl3NOS and a molecular weight of 360.69 g/mol. Its IUPAC name is 3-phenyl-2-sulfanyl-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-phenyl-2-sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 107020178 |
| Molecular Formula | C15H12Cl3NOS |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 3-phenyl-2-sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C15H12Cl3NOS/c16-10-7-12(18)13(8-11(10)17)19-15(20)14(21)6-9-4-2-1-3-5-9/h1-5,7-8,14,21H,6H2,(H,19,20) |
| InChIKey | ALPNHJORODIAKC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|