(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid

C11H10F3NO2 — CID 103249627

IUPAC(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid
SMILESC/C(=C/CNc1cc(F)cc(F)c1F)C(=O)O
InChIInChI=1S/C11H10F3NO2/c1-6(11(16)17)2-3-15-9-5-7(12)4-8(13)10(9)14/h2,4-5,15H,3H2,1H3,(H,16,17)/b6-2-
InChIKeyLOYUTOIHBPJQQF-KXFIGUGUSA-N
MW245.20 g/mol
LogP2.55
Rot. Bonds4

About (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid

(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid (PubChem CID 103249627) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid
PubChem CID103249627
Molecular FormulaC11H10F3NO2
Molecular Weight245.20 g/mol
Exact Mass245.07
IUPAC Name(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid
SMILESC/C(=C/CNc1cc(F)cc(F)c1F)C(=O)O
InChIInChI=1S/C11H10F3NO2/c1-6(11(16)17)2-3-15-9-5-7(12)4-8(13)10(9)14/h2,4-5,15H,3H2,1H3,(H,16,17)/b6-2-
InChIKeyLOYUTOIHBPJQQF-KXFIGUGUSA-N
XLogP2.55
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.20
LogP ≤ 52.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid?
The IUPAC name of (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid (CID 103249627) is (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid.
What is the SMILES notation for (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid?
The canonical SMILES for (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid is C/C(=C/CNc1cc(F)cc(F)c1F)C(=O)O.
What is the InChIKey of (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid?
The InChIKey is LOYUTOIHBPJQQF-KXFIGUGUSA-N. The full InChI is InChI=1S/C11H10F3NO2/c1-6(11(16)17)2-3-15-9-5-7(12)4-8(13)10(9)14/h2,4-5,15H,3H2,1H3,(H,16,17)/b6-2-.
What are the key properties of (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid?
(Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid has a molecular weight of 245.20 g/mol, XLogP of 2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methyl-4-(2,3,5-trifluoroanilino)but-2-enoic acid is sourced from PubChem (CID 103249627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).