C12H11BrF3NO2 — CID 103239531
(Z)-4-[4-bromo-2-(trifluoromethyl)anilino]-2-methylbut-2-enoic acid (PubChem CID 103239531) has the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. Its IUPAC name is (Z)-4-[4-bromo-2-(trifluoromethyl)anilino]-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-[4-bromo-2-(trifluoromethyl)anilino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103239531 |
| Molecular Formula | C12H11BrF3NO2 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | (Z)-4-[4-bromo-2-(trifluoromethyl)anilino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C/CNc1ccc(Br)cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H11BrF3NO2/c1-7(11(18)19)4-5-17-10-3-2-8(13)6-9(10)12(14,15)16/h2-4,6,17H,5H2,1H3,(H,18,19)/b7-4- |
| InChIKey | SXFXFTAZWNGOJL-DAXSKMNVSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|