C8H7F3N2O4 — CID 174886791
1-(3,5-difluorophenyl)-2-fluorohydrazine;oxalic acid (PubChem CID 174886791) has the molecular formula C8H7F3N2O4 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-fluorohydrazine;oxalic acid.
| Compound Name | 1-(3,5-difluorophenyl)-2-fluorohydrazine;oxalic acid |
|---|---|
| PubChem CID | 174886791 |
| Molecular Formula | C8H7F3N2O4 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-fluorohydrazine;oxalic acid |
| SMILES | FNNc1cc(F)cc(F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C6H5F3N2.C2H2O4/c7-4-1-5(8)3-6(2-4)10-11-9;3-1(4)2(5)6/h1-3,10-11H;(H,3,4)(H,5,6) |
| InChIKey | AOKLVBGEZUYWDY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|