3-amino-2-(3,5-difluoroanilino)propanoic acid

C9H10F2N2O2 — CID 130492143

IUPAC3-amino-2-(3,5-difluoroanilino)propanoic acid
SMILESNCC(Nc1cc(F)cc(F)c1)C(=O)O
InChIInChI=1S/C9H10F2N2O2/c10-5-1-6(11)3-7(2-5)13-8(4-12)9(14)15/h1-3,8,13H,4,12H2,(H,14,15)
InChIKeyKTFJNMDECXHFIU-UHFFFAOYSA-N
MW216.19 g/mol
LogP0.79
Rot. Bonds4

About 3-amino-2-(3,5-difluoroanilino)propanoic acid

3-amino-2-(3,5-difluoroanilino)propanoic acid (PubChem CID 130492143) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-amino-2-(3,5-difluoroanilino)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(3,5-difluoroanilino)propanoic acid
PubChem CID130492143
Molecular FormulaC9H10F2N2O2
Molecular Weight216.19 g/mol
Exact Mass216.07
IUPAC Name3-amino-2-(3,5-difluoroanilino)propanoic acid
SMILESNCC(Nc1cc(F)cc(F)c1)C(=O)O
InChIInChI=1S/C9H10F2N2O2/c10-5-1-6(11)3-7(2-5)13-8(4-12)9(14)15/h1-3,8,13H,4,12H2,(H,14,15)
InChIKeyKTFJNMDECXHFIU-UHFFFAOYSA-N
XLogP0.79
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.19
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-amino-2-(3,5-difluoroanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(3,5-difluoroanilino)propanoic acid?
The IUPAC name of 3-amino-2-(3,5-difluoroanilino)propanoic acid (CID 130492143) is 3-amino-2-(3,5-difluoroanilino)propanoic acid.
What is the SMILES notation for 3-amino-2-(3,5-difluoroanilino)propanoic acid?
The canonical SMILES for 3-amino-2-(3,5-difluoroanilino)propanoic acid is NCC(Nc1cc(F)cc(F)c1)C(=O)O.
What is the InChIKey of 3-amino-2-(3,5-difluoroanilino)propanoic acid?
The InChIKey is KTFJNMDECXHFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O2/c10-5-1-6(11)3-7(2-5)13-8(4-12)9(14)15/h1-3,8,13H,4,12H2,(H,14,15).
What are the key properties of 3-amino-2-(3,5-difluoroanilino)propanoic acid?
3-amino-2-(3,5-difluoroanilino)propanoic acid has a molecular weight of 216.19 g/mol, XLogP of 0.79, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3,5-difluoroanilino)propanoic acid is sourced from PubChem (CID 130492143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).