C8H10F2N2 — CID 11116511
N'-(3,5-difluorophenyl)ethane-1,2-diamine (PubChem CID 11116511) has the molecular formula C8H10F2N2 and a molecular weight of 172.18 g/mol. Its IUPAC name is N'-(3,5-difluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11116511 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N'-(3,5-difluorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H10F2N2/c9-6-3-7(10)5-8(4-6)12-2-1-11/h3-5,12H,1-2,11H2 |
| InChIKey | CAQYIRMKAIUGBC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |