C9H13FN2 — CID 79692011
N'-(3-fluoro-5-methylphenyl)ethane-1,2-diamine (PubChem CID 79692011) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is N'-(3-fluoro-5-methylphenyl)ethane-1,2-diamine.
| Compound Name | N'-(3-fluoro-5-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79692011 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | N'-(3-fluoro-5-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(F)cc(NCCN)c1 |
| InChI | InChI=1S/C9H13FN2/c1-7-4-8(10)6-9(5-7)12-3-2-11/h4-6,12H,2-3,11H2,1H3 |
| InChIKey | WAYSVNSVSGAFSO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |