C8H9F3N2 — CID 82504640
N'-(3,4,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 82504640) has the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. Its IUPAC name is N'-(3,4,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82504640 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N'-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H9F3N2/c9-6-3-5(13-2-1-12)4-7(10)8(6)11/h3-4,13H,1-2,12H2 |
| InChIKey | DLHBKEIFMSKXFC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|