C9H9F3N2O — CID 62810096
3-(3,4,5-trifluoroanilino)propanamide (PubChem CID 62810096) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is 3-(3,4,5-trifluoroanilino)propanamide.
| Compound Name | 3-(3,4,5-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 62810096 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3-(3,4,5-trifluoroanilino)propanamide |
| SMILES | NC(=O)CCNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H9F3N2O/c10-6-3-5(4-7(11)9(6)12)14-2-1-8(13)15/h3-4,14H,1-2H2,(H2,13,15) |
| InChIKey | IRJFQRHFKVYYTN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|