C10H12F2N2O — CID 82818003
3-(2,6-difluoro-3-methylanilino)propanamide (PubChem CID 82818003) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(2,6-difluoro-3-methylanilino)propanamide.
| Compound Name | 3-(2,6-difluoro-3-methylanilino)propanamide |
|---|---|
| PubChem CID | 82818003 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-(2,6-difluoro-3-methylanilino)propanamide |
| SMILES | Cc1ccc(F)c(NCCC(N)=O)c1F |
| InChI | InChI=1S/C10H12F2N2O/c1-6-2-3-7(11)10(9(6)12)14-5-4-8(13)15/h2-3,14H,4-5H2,1H3,(H2,13,15) |
| InChIKey | BPLGDWFFSWEONR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |