C8H10Cl2N2O — CID 130589167
4-(2-aminoethylamino)-2,6-dichlorophenol (PubChem CID 130589167) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-2,6-dichlorophenol.
| Compound Name | 4-(2-aminoethylamino)-2,6-dichlorophenol |
|---|---|
| PubChem CID | 130589167 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 4-(2-aminoethylamino)-2,6-dichlorophenol |
| SMILES | NCCNc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N2O/c9-6-3-5(12-2-1-11)4-7(10)8(6)13/h3-4,12-13H,1-2,11H2 |
| InChIKey | RRNOXZUCRMQGTJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|