C8H9Cl2NO — CID 82550826
2,6-dichloro-4-(ethylamino)phenol (PubChem CID 82550826) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 2,6-dichloro-4-(ethylamino)phenol.
| Compound Name | 2,6-dichloro-4-(ethylamino)phenol |
|---|---|
| PubChem CID | 82550826 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 2,6-dichloro-4-(ethylamino)phenol |
| SMILES | CCNc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2NO/c1-2-11-5-3-6(9)8(12)7(10)4-5/h3-4,11-12H,2H2,1H3 |
| InChIKey | JCVKISVHDADDKS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|