C8H11ClN2 — CID 68788899
2-chloro-4-N-ethylbenzene-1,4-diamine (PubChem CID 68788899) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-chloro-4-N-ethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-ethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 68788899 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-chloro-4-N-ethylbenzene-1,4-diamine |
| SMILES | CCNc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C8H11ClN2/c1-2-11-6-3-4-8(10)7(9)5-6/h3-5,11H,2,10H2,1H3 |
| InChIKey | NJHKYMHEDWGAIV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|