C11H18ClN3 — CID 126636290
2-chloro-4-N-[3-(dimethylamino)propyl]benzene-1,4-diamine (PubChem CID 126636290) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-chloro-4-N-[3-(dimethylamino)propyl]benzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[3-(dimethylamino)propyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 126636290 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-chloro-4-N-[3-(dimethylamino)propyl]benzene-1,4-diamine |
| SMILES | CN(C)CCCNc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3/c1-15(2)7-3-6-14-9-4-5-11(13)10(12)8-9/h4-5,8,14H,3,6-7,13H2,1-2H3 |
| InChIKey | MIVVVDOAAMPBBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|