C11H14ClN3O3 — CID 108516095
N-(4-amino-3-chlorophenyl)-N'-(2-hydroxyethyl)-N'-methyloxamide (PubChem CID 108516095) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-N'-(2-hydroxyethyl)-N'-methyloxamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-N'-(2-hydroxyethyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108516095 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-N'-(2-hydroxyethyl)-N'-methyloxamide |
| SMILES | CN(CCO)C(=O)C(=O)Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O3/c1-15(4-5-16)11(18)10(17)14-7-2-3-9(13)8(12)6-7/h2-3,6,16H,4-5,13H2,1H3,(H,14,17) |
| InChIKey | WGLCTOUAEBYSLQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|