C12H14N4O3 — CID 108526708
N-(3H-benzimidazol-5-yl)-N'-(2-hydroxyethyl)-N'-methyloxamide (PubChem CID 108526708) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N'-(2-hydroxyethyl)-N'-methyloxamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N'-(2-hydroxyethyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108526708 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N'-(2-hydroxyethyl)-N'-methyloxamide |
| SMILES | CN(CCO)C(=O)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H14N4O3/c1-16(4-5-17)12(19)11(18)15-8-2-3-9-10(6-8)14-7-13-9/h2-3,6-7,17H,4-5H2,1H3,(H,13,14)(H,15,18) |
| InChIKey | UXDAMMWEBLENAA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|