C12H16N4O3 — CID 108885821
3-(3H-benzimidazol-5-yl)-1,1-bis(2-hydroxyethyl)urea (PubChem CID 108885821) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-yl)-1,1-bis(2-hydroxyethyl)urea.
| Compound Name | 3-(3H-benzimidazol-5-yl)-1,1-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 108885821 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-(3H-benzimidazol-5-yl)-1,1-bis(2-hydroxyethyl)urea |
| SMILES | O=C(Nc1ccc2nc[nH]c2c1)N(CCO)CCO |
| InChI | InChI=1S/C12H16N4O3/c17-5-3-16(4-6-18)12(19)15-9-1-2-10-11(7-9)14-8-13-10/h1-2,7-8,17-18H,3-6H2,(H,13,14)(H,15,19) |
| InChIKey | KJGMDSHTIRAUKE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |