C11H16F2N2 — CID 114525058
N-(3,5-difluorophenyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 114525058) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(3,5-difluorophenyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114525058 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H16F2N2/c1-15(2)5-3-4-14-11-7-9(12)6-10(13)8-11/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | HOBZWFOIXUPMIO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|