C12H17F2N — CID 141112133
4-(3,5-difluorophenyl)-N,N-dimethylbutan-1-amine (PubChem CID 141112133) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(3,5-difluorophenyl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 141112133 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-15(2)6-4-3-5-10-7-11(13)9-12(14)8-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | CJPRWNMMDFLSKM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|