C11H15FIN — CID 170866056
3-(3-fluoro-5-iodophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866056) has the molecular formula C11H15FIN and a molecular weight of 307.15 g/mol. Its IUPAC name is 3-(3-fluoro-5-iodophenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-fluoro-5-iodophenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866056 |
| Molecular Formula | C11H15FIN |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-(3-fluoro-5-iodophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1cc(F)cc(I)c1 |
| InChI | InChI=1S/C11H15FIN/c1-14(2)5-3-4-9-6-10(12)8-11(13)7-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | DTEDTYHEZQPFIC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|