C11H17NO3 — CID 170865399
5-[3-(dimethylamino)propyl]benzene-1,2,3-triol (PubChem CID 170865399) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl]benzene-1,2,3-triol.
| Compound Name | 5-[3-(dimethylamino)propyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170865399 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-[3-(dimethylamino)propyl]benzene-1,2,3-triol |
| SMILES | CN(C)CCCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-12(2)5-3-4-8-6-9(13)11(15)10(14)7-8/h6-7,13-15H,3-5H2,1-2H3 |
| InChIKey | OOZRHPHINPZDRZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|