C42H81N3O — CID 150884790
2,4,6-tris[10-(dimethylamino)decyl]phenol (PubChem CID 150884790) has the molecular formula C42H81N3O and a molecular weight of 644.13 g/mol. Its IUPAC name is 2,4,6-tris[10-(dimethylamino)decyl]phenol.
| Compound Name | 2,4,6-tris[10-(dimethylamino)decyl]phenol |
|---|---|
| PubChem CID | 150884790 |
| Molecular Formula | C42H81N3O |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.64 |
| IUPAC Name | 2,4,6-tris[10-(dimethylamino)decyl]phenol |
| SMILES | CN(C)CCCCCCCCCCc1cc(CCCCCCCCCCN(C)C)c(O)c(CCCCCCCCCCN(C)C)c1 |
| InChI | InChI=1S/C42H81N3O/c1-43(2)34-28-22-16-10-7-13-19-25-31-39-37-40(32-26-20-14-8-11-17-23-29-35-44(3)4)42(46)41(38-39)33-27-21-15-9-12-18-24-30-36-45(5)6/h37-38,46H,7-36H2,1-6H3 |
| InChIKey | KWTRKFGENNUJCB-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|