C10H13BrFN — CID 171396178
2-(3-bromo-5-fluorophenyl)-N,N-dimethylethanamine (PubChem CID 171396178) has the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-N,N-dimethylethanamine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 171396178 |
| Molecular Formula | C10H13BrFN |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C10H13BrFN/c1-13(2)4-3-8-5-9(11)7-10(12)6-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | KWKCKQPIXAVEOL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |