About 1-(3-bromopropyl)-3,5-difluorobenzene
1-(3-bromopropyl)-3,5-difluorobenzene (PubChem CID 53433983) has the molecular formula C9H9BrF2
and a molecular weight of 235.07 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-3,5-difluorobenzene |
| PubChem CID | 53433983 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 1-(3-bromopropyl)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(CCCBr)c1 |
| InChI | InChI=1S/C9H9BrF2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h4-6H,1-3H2 |
| InChIKey | FLZOAGVUGYVJDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-3,5-difluorobenzene?
The IUPAC name of 1-(3-bromopropyl)-3,5-difluorobenzene (CID 53433983) is 1-(3-bromopropyl)-3,5-difluorobenzene.
What is the SMILES notation for 1-(3-bromopropyl)-3,5-difluorobenzene?
The canonical SMILES for 1-(3-bromopropyl)-3,5-difluorobenzene is Fc1cc(F)cc(CCCBr)c1.
What is the InChIKey of 1-(3-bromopropyl)-3,5-difluorobenzene?
The InChIKey is FLZOAGVUGYVJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h4-6H,1-3H2.
What are the key properties of 1-(3-bromopropyl)-3,5-difluorobenzene?
1-(3-bromopropyl)-3,5-difluorobenzene has a molecular weight of 235.07 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-3,5-difluorobenzene is sourced from PubChem (CID 53433983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).