C10H10F5N — CID 115513493
3,5-difluoro-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 115513493) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is 3,5-difluoro-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 3,5-difluoro-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 115513493 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3,5-difluoro-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | Fc1cc(F)cc(NCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F5N/c11-7-4-8(12)6-9(5-7)16-3-1-2-10(13,14)15/h4-6,16H,1-3H2 |
| InChIKey | CZTDMOQFKZZXRV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|