C10H8F4N2 — CID 70982475
3-fluoro-5-(3,3,3-trifluoropropylamino)benzonitrile (PubChem CID 70982475) has the molecular formula C10H8F4N2 and a molecular weight of 232.18 g/mol. Its IUPAC name is 3-fluoro-5-(3,3,3-trifluoropropylamino)benzonitrile.
| Compound Name | 3-fluoro-5-(3,3,3-trifluoropropylamino)benzonitrile |
|---|---|
| PubChem CID | 70982475 |
| Molecular Formula | C10H8F4N2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-fluoro-5-(3,3,3-trifluoropropylamino)benzonitrile |
| SMILES | N#Cc1cc(F)cc(NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F4N2/c11-8-3-7(6-15)4-9(5-8)16-2-1-10(12,13)14/h3-5,16H,1-2H2 |
| InChIKey | BEDDOLBCQOFSJI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |