C10H7F8N — CID 115520487
2,3,4,5,6-pentafluoro-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 115520487) has the molecular formula C10H7F8N and a molecular weight of 293.16 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 115520487 |
| Molecular Formula | C10H7F8N |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | Fc1c(F)c(F)c(NCCCC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H7F8N/c11-4-5(12)7(14)9(8(15)6(4)13)19-3-1-2-10(16,17)18/h19H,1-3H2 |
| InChIKey | OGCBCVCKVNFUSO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|