C9H9F4NOS — CID 146590652
2,3,5,6-tetrafluoro-4-(3-sulfanylpropylamino)phenol (PubChem CID 146590652) has the molecular formula C9H9F4NOS and a molecular weight of 255.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(3-sulfanylpropylamino)phenol.
| Compound Name | 2,3,5,6-tetrafluoro-4-(3-sulfanylpropylamino)phenol |
|---|---|
| PubChem CID | 146590652 |
| Molecular Formula | C9H9F4NOS |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(3-sulfanylpropylamino)phenol |
| SMILES | Oc1c(F)c(F)c(NCCCS)c(F)c1F |
| InChI | InChI=1S/C9H9F4NOS/c10-4-6(12)9(15)7(13)5(11)8(4)14-2-1-3-16/h14-16H,1-3H2 |
| InChIKey | PVGJTNVVTBNBLU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|