C6H2ClF5O — CID 172845059
2,3,4,5,6-pentafluorophenol;hydrochloride (PubChem CID 172845059) has the molecular formula C6H2ClF5O and a molecular weight of 220.52 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorophenol;hydrochloride.
| Compound Name | 2,3,4,5,6-pentafluorophenol;hydrochloride |
|---|---|
| PubChem CID | 172845059 |
| Molecular Formula | C6H2ClF5O |
| Molecular Weight | 220.52 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 2,3,4,5,6-pentafluorophenol;hydrochloride |
| SMILES | Cl.Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5O.ClH/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;1H |
| InChIKey | XHORZKSEGMHLKZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|