C14H2F8O2 — CID 22178338
2,3,4,6,7,8,9,10-octafluorophenanthrene-1,5-diol (PubChem CID 22178338) has the molecular formula C14H2F8O2 and a molecular weight of 354.15 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octafluorophenanthrene-1,5-diol.
| Compound Name | 2,3,4,6,7,8,9,10-octafluorophenanthrene-1,5-diol |
|---|---|
| PubChem CID | 22178338 |
| Molecular Formula | C14H2F8O2 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octafluorophenanthrene-1,5-diol |
| SMILES | Oc1c(F)c(F)c(F)c2c1c(F)c(F)c1c(F)c(F)c(F)c(O)c12 |
| InChI | InChI=1S/C14H2F8O2/c15-5-1-2-3(7(17)10(20)11(21)13(2)23)6(16)8(18)4(1)14(24)12(22)9(5)19/h23-24H |
| InChIKey | CRNHRNWSDGXWNJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|