C14H4F6O2 — CID 22178277
2,3,4,5,6,7-hexafluorophenanthrene-1,9-diol (PubChem CID 22178277) has the molecular formula C14H4F6O2 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexafluorophenanthrene-1,9-diol.
| Compound Name | 2,3,4,5,6,7-hexafluorophenanthrene-1,9-diol |
|---|---|
| PubChem CID | 22178277 |
| Molecular Formula | C14H4F6O2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2,3,4,5,6,7-hexafluorophenanthrene-1,9-diol |
| SMILES | Oc1cc2c(O)c(F)c(F)c(F)c2c2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C14H4F6O2/c15-5-1-3-6(21)2-4-8(7(3)10(17)9(5)16)11(18)12(19)13(20)14(4)22/h1-2,21-22H |
| InChIKey | ZUCHJBZJADKSJR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|