C11H7F4NO — CID 18457400
2,3,6,7-tetrafluoro-5-(methylamino)naphthalen-1-ol (PubChem CID 18457400) has the molecular formula C11H7F4NO and a molecular weight of 245.17 g/mol. Its IUPAC name is 2,3,6,7-tetrafluoro-5-(methylamino)naphthalen-1-ol.
| Compound Name | 2,3,6,7-tetrafluoro-5-(methylamino)naphthalen-1-ol |
|---|---|
| PubChem CID | 18457400 |
| Molecular Formula | C11H7F4NO |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,3,6,7-tetrafluoro-5-(methylamino)naphthalen-1-ol |
| SMILES | CNc1c(F)c(F)cc2c(O)c(F)c(F)cc12 |
| InChI | InChI=1S/C11H7F4NO/c1-16-10-4-2-7(13)9(15)11(17)5(4)3-6(12)8(10)14/h2-3,16-17H,1H3 |
| InChIKey | XKAVRNIJIADLBA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |