C11H9F2N — CID 141091766
2,3-difluoro-N-methylnaphthalen-1-amine (PubChem CID 141091766) has the molecular formula C11H9F2N and a molecular weight of 193.20 g/mol. Its IUPAC name is 2,3-difluoro-N-methylnaphthalen-1-amine.
| Compound Name | 2,3-difluoro-N-methylnaphthalen-1-amine |
|---|---|
| PubChem CID | 141091766 |
| Molecular Formula | C11H9F2N |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2,3-difluoro-N-methylnaphthalen-1-amine |
| SMILES | CNc1c(F)c(F)cc2ccccc12 |
| InChI | InChI=1S/C11H9F2N/c1-14-11-8-5-3-2-4-7(8)6-9(12)10(11)13/h2-6,14H,1H3 |
| InChIKey | IWYFXUZPHJITBV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |