C17H10F4N2S — CID 17298792
1-naphthalen-1-yl-3-(2,3,5,6-tetrafluorophenyl)thiourea (PubChem CID 17298792) has the molecular formula C17H10F4N2S and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-naphthalen-1-yl-3-(2,3,5,6-tetrafluorophenyl)thiourea.
| Compound Name | 1-naphthalen-1-yl-3-(2,3,5,6-tetrafluorophenyl)thiourea |
|---|---|
| PubChem CID | 17298792 |
| Molecular Formula | C17H10F4N2S |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1-naphthalen-1-yl-3-(2,3,5,6-tetrafluorophenyl)thiourea |
| SMILES | Fc1cc(F)c(F)c(NC(=S)Nc2cccc3ccccc23)c1F |
| InChI | InChI=1S/C17H10F4N2S/c18-11-8-12(19)15(21)16(14(11)20)23-17(24)22-13-7-3-5-9-4-1-2-6-10(9)13/h1-8H,(H2,22,23,24) |
| InChIKey | RSRXQBFFJSPROF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|