C18H13F2N3S — CID 127026747
1-[(E)-(2,3-difluorophenyl)methylideneamino]-3-naphthalen-1-ylthiourea (PubChem CID 127026747) has the molecular formula C18H13F2N3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[(E)-(2,3-difluorophenyl)methylideneamino]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[(E)-(2,3-difluorophenyl)methylideneamino]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 127026747 |
| Molecular Formula | C18H13F2N3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-[(E)-(2,3-difluorophenyl)methylideneamino]-3-naphthalen-1-ylthiourea |
| SMILES | Fc1cccc(/C=N/NC(=S)Nc2cccc3ccccc23)c1F |
| InChI | InChI=1S/C18H13F2N3S/c19-15-9-3-7-13(17(15)20)11-21-23-18(24)22-16-10-4-6-12-5-1-2-8-14(12)16/h1-11H,(H2,22,23,24)/b21-11+ |
| InChIKey | LAPCANZJWCOOCV-SRZZPIQSSA-N |
| XLogP | 4.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|