C8H7F2N3O — CID 10012988
[(E)-(2,3-difluorophenyl)methylideneamino]urea (PubChem CID 10012988) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is [(E)-(2,3-difluorophenyl)methylideneamino]urea.
| Compound Name | [(E)-(2,3-difluorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 10012988 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | [(E)-(2,3-difluorophenyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1cccc(F)c1F |
| InChI | InChI=1S/C8H7F2N3O/c9-6-3-1-2-5(7(6)10)4-12-13-8(11)14/h1-4H,(H3,11,13,14)/b12-4+ |
| InChIKey | IYKIMSQIJBCMKW-UUILKARUSA-N |
| XLogP | 0.97 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|