C9H6F5N3O2 — CID 168533588
[[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]urea (PubChem CID 168533588) has the molecular formula C9H6F5N3O2 and a molecular weight of 283.16 g/mol. Its IUPAC name is [[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]urea.
| Compound Name | [[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533588 |
| Molecular Formula | C9H6F5N3O2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [[2,4-difluoro-3-(trifluoromethoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(F)c(OC(F)(F)F)c1F |
| InChI | InChI=1S/C9H6F5N3O2/c10-5-2-1-4(3-16-17-8(15)18)6(11)7(5)19-9(12,13)14/h1-3H,(H3,15,17,18) |
| InChIKey | KTAHGKDWNOEOKQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|