C9H7F3IN3O3 — CID 168533600
[[2-hydroxy-3-iodo-5-(trifluoromethoxy)phenyl]methylideneamino]urea (PubChem CID 168533600) has the molecular formula C9H7F3IN3O3 and a molecular weight of 389.07 g/mol. Its IUPAC name is [[2-hydroxy-3-iodo-5-(trifluoromethoxy)phenyl]methylideneamino]urea.
| Compound Name | [[2-hydroxy-3-iodo-5-(trifluoromethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533600 |
| Molecular Formula | C9H7F3IN3O3 |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | [[2-hydroxy-3-iodo-5-(trifluoromethoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cc(OC(F)(F)F)cc(I)c1O |
| InChI | InChI=1S/C9H7F3IN3O3/c10-9(11,12)19-5-1-4(3-15-16-8(14)18)7(17)6(13)2-5/h1-3,17H,(H3,14,16,18) |
| InChIKey | DLEVVVSLDPNCEU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|