C15H10Br2I2N4O3 — CID 3450915
1,3-bis[(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea (PubChem CID 3450915) has the molecular formula C15H10Br2I2N4O3 and a molecular weight of 707.89 g/mol. Its IUPAC name is 1,3-bis[(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 3450915 |
| Molecular Formula | C15H10Br2I2N4O3 |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 705.72 |
| IUPAC Name | 1,3-bis[(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea |
| SMILES | O=C(NN=Cc1cc(Br)cc(I)c1O)NN=Cc1cc(Br)cc(I)c1O |
| InChI | InChI=1S/C15H10Br2I2N4O3/c16-9-1-7(13(24)11(18)3-9)5-20-22-15(26)23-21-6-8-2-10(17)4-12(19)14(8)25/h1-6,24-25H,(H2,22,23,26) |
| InChIKey | GAVYAYBUPBJGMP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|