C8H7BrIN3O2 — CID 136887163
[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea (PubChem CID 136887163) has the molecular formula C8H7BrIN3O2 and a molecular weight of 383.97 g/mol. Its IUPAC name is [(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea.
| Compound Name | [(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 136887163 |
| Molecular Formula | C8H7BrIN3O2 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | [(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C\c1cc(Br)cc(I)c1O |
| InChI | InChI=1S/C8H7BrIN3O2/c9-5-1-4(3-12-13-8(11)15)7(14)6(10)2-5/h1-3,14H,(H3,11,13,15)/b12-3- |
| InChIKey | LIGPDXYYYSLLKO-BASWHVEKSA-N |
| XLogP | 1.76 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|