C16H9Br2IN2O3 — CID 137173741
5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 137173741) has the molecular formula C16H9Br2IN2O3 and a molecular weight of 563.97 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137173741 |
| Molecular Formula | C16H9Br2IN2O3 |
| Molecular Weight | 563.97 g/mol |
| Exact Mass | 561.80 |
| IUPAC Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-iodophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc(I)c1O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C16H9Br2IN2O3/c17-10-1-2-13-8(3-10)5-14(24-13)16(23)21-20-7-9-4-11(18)6-12(19)15(9)22/h1-7,22H,(H,21,23)/b20-7- |
| InChIKey | UFGSIFSPDTVEMZ-SCDVKCJHSA-N |
| XLogP | 5.03 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.97 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|