C22H15BrN4O3 — CID 137173960
5-bromo-N-[(E)-(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 137173960) has the molecular formula C22H15BrN4O3 and a molecular weight of 463.29 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137173960 |
| Molecular Formula | C22H15BrN4O3 |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 5-bromo-N-[(E)-(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(/N=N/c2ccccc2)ccc1O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C22H15BrN4O3/c23-16-6-9-20-14(10-16)12-21(30-20)22(29)27-24-13-15-11-18(7-8-19(15)28)26-25-17-4-2-1-3-5-17/h1-13,28H,(H,27,29)/b24-13+,26-25+ |
| InChIKey | XYLVVJOWILQWGK-ZXSYOUNQSA-N |
| XLogP | 6.08 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|