C19H11BrClN3O2 — CID 3518174
5-bromo-N-[(2-chloroquinolin-3-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 3518174) has the molecular formula C19H11BrClN3O2 and a molecular weight of 428.67 g/mol. Its IUPAC name is 5-bromo-N-[(2-chloroquinolin-3-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(2-chloroquinolin-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3518174 |
| Molecular Formula | C19H11BrClN3O2 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 5-bromo-N-[(2-chloroquinolin-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NN=Cc1cc2ccccc2nc1Cl)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C19H11BrClN3O2/c20-14-5-6-16-12(8-14)9-17(26-16)19(25)24-22-10-13-7-11-3-1-2-4-15(11)23-18(13)21/h1-10H,(H,24,25) |
| InChIKey | YQOJHOFOFQDXHN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|