C19H15BrN2O5 — CID 126107454
5-bromo-N-[(Z)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126107454) has the molecular formula C19H15BrN2O5 and a molecular weight of 431.24 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126107454 |
| Molecular Formula | C19H15BrN2O5 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 5-bromo-N-[(Z)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc2c(cc1/C=N\NC(=O)c1cc3cc(Br)ccc3o1)OCO2 |
| InChI | InChI=1S/C19H15BrN2O5/c1-2-24-15-8-17-16(25-10-26-17)7-12(15)9-21-22-19(23)18-6-11-5-13(20)3-4-14(11)27-18/h3-9H,2,10H2,1H3,(H,22,23)/b21-9- |
| InChIKey | VLUPNXJWOSLVKX-NKVSQWTQSA-N |
| XLogP | 4.09 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|