C18H17BrN2O5 — CID 126100905
5-bromo-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methoxybenzamide (PubChem CID 126100905) has the molecular formula C18H17BrN2O5 and a molecular weight of 421.25 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 126100905 |
| Molecular Formula | C18H17BrN2O5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 5-bromo-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methoxybenzamide |
| SMILES | CCOc1cc2c(cc1/C=N/NC(=O)c1cc(Br)ccc1OC)OCO2 |
| InChI | InChI=1S/C18H17BrN2O5/c1-3-24-15-8-17-16(25-10-26-17)6-11(15)9-20-21-18(22)13-7-12(19)4-5-14(13)23-2/h4-9H,3,10H2,1-2H3,(H,21,22)/b20-9+ |
| InChIKey | DRDCTWXDNUZOPJ-AWQFTUOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|