C19H17BrN2O5 — CID 5433414
5-bromo-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 5433414) has the molecular formula C19H17BrN2O5 and a molecular weight of 433.26 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 5433414 |
| Molecular Formula | C19H17BrN2O5 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 5-bromo-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)c2cc3cc(Br)ccc3o2)c(OC)c1 |
| InChI | InChI=1S/C19H17BrN2O5/c1-24-13-8-16(25-2)14(17(9-13)26-3)10-21-22-19(23)18-7-11-6-12(20)4-5-15(11)27-18/h4-10H,1-3H3,(H,22,23)/b21-10- |
| InChIKey | XFZQTTBKIACCCE-FBHDLOMBSA-N |
| XLogP | 3.98 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|